విటమిన్ బీ12: కూర్పుల మధ్య తేడాలు

చి వర్గం:విటమిన్లు చేర్చబడింది (హాట్‌కేట్ ఉపయోగించి)
పంక్తి 1:
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477163311
| IUPAC_name = α-(5,6-dimethylbenzimidazolyl)cobamidcyanide
| image = cobalamin.png
| width = 200
 
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|monograph|vitamin_b12}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = POM
| legal_US = OTC
| routes_of_administration = oral, [[intravenous|IV]], IM
 
<!--Pharmacokinetic data-->
| bioavailability = Readily absorbed in distal half of the ileum
| protein_bound = Very high to specific [[transcobalamins]] plasma proteins<br>Binding of [[hydroxocobalamin]] is slightly higher than cyanocobalamin.
| metabolism = [[hepatic]]
| elimination_half-life = Approximately 6 days<br>(400 days in the liver)
| excretion = [[Renal]]
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 68-19-9
| ATC_prefix = B03
| ATC_suffix = BA01
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C62H90N13O14P.CN.Co/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72–42)32(4)54(59)73–56;1–2;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H15,63,64,65,66,67,68,69,71,72,73,74,77,78,79,80,81,82,83,85,86);;/q;;+2/p-2/t31?,34-,35-,36-,37+,41-,52-,53-,56-,57+,59-,60+,61+,62+;;/m1../s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RMRCNWBMXRMIRW-WYVZQNDMSA-L
| PubChem = 5479203
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00115
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10469504
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00166
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1697777
 
<!--Chemical data-->
| C=63 | H=88 | Co=1 | N=14 | O=14 | P=1
| molecular_weight = 1355.37 g/mol
| smiles = NC(=O)C[C@@]8(C)[C@H](CCC(N)=O)C=2/N=C8/C(/C)=C1/[C@@H](CCC(N)=O)[C@](C)(CC(N)=O)[C@@](C)(N1[Co+]C#N)[C@@H]7/N=C(C(\C)=C3/N=C(/C=2)C(C)(C)[C@@H]3CCC(N)=O)[C@](C)(CCC(=O)NCC(C)OP([O-])(=O)O[C@@H]6[C@@H](CO)O[C@H](n5cnc4cc(C)c(C)cc45)[C@@H]6O)[C@H]7CC(N)=O
}}
[[File:B12 methylcobalamin.jpg|thumb|285px|Methylcobalamin (shown) is a form of vitamin B<sub>12</sub>. Physically it resembles the other forms of vitamin B<sub>12</sub>, occurring as dark red crystals that freely form cherry-colored transparent solutions in water.]]
మన నాడీ వ్యవస్థ ఆరోగ్యంగా ఉండటానికి, ఎర్ర రక్తకణాల తయారీకి బీ12 విటమిన్ తప్పనిసరి. దీని లోపం కొద్ది మోతాదులోనే ఉంటే కండరాల బలహీనత, నిస్సత్తువ, వణుకు, మూత్రం ఆపుకోలేకపోవటం, రక్తపోటు తక్కువ కావటం, కుంగుబాటు, మతిమరుపు వంటి గ్రహణ సమస్యలు తలెత్తుతాయి. ఇక లోపం మరీ తీవ్రమైతే మాత్రం రక్తహీనతకు దారితీస్తుంది. అన్ని బీ విటమన్ల మాదిరిగానే బీ12 కూడా నీటిలో కరుగుతుంది. అయితే మోతాదు ఎక్కువగా ఉంటే దీన్ని మన శరీరం.. కాలేయం, కణజాలాల్లో నిల్వ చేసుకుంటుంది. అందువల్ల ఆహారం ద్వారా తగినంత బీ12 తీసుకోకపోయినా చాలాకాలం పాటు రక్తంలో దీని మోతాదు తగ్గినట్టు కనిపించదు. ఒకవేళ నిల్వ మోతాదు తక్కువగా ఉంటే చాలా త్వరగానే బీ12 లోపం కనబడొచ్చు. పిల్లల్లోనైతే అంతకన్నా ముందుగానే ప్రభావం చూపుతుంది.
==వృద్దులలో సమస్యలు==
"https://te.wikipedia.org/wiki/విటమిన్_బీ12" నుండి వెలికితీశారు