సక్సినిక్ ఆమ్లం

సక్సినిక్ ఆమ్లం లేదా సక్సినికామ్లం Succinic acid (/[unsupported input]səkˈsɪnk/; IUPAC systematic name: butanedioic acid; historically known as spirit of amber) ఒక డైకార్బాక్సిలిక్ ఆమ్లం. (dicarboxylic acid). ఇది సిట్రిక్ ఆమ్ల వలయం (citric acid cycle) లో ప్రముఖ పాత్ర పోషిస్తుంది. ఈ చక్రంలో ఎలక్ట్రాన్ దాతగా పనిచేస్తుంది.

సక్సినిక్ ఆమ్లం
IUPAC నామము
Butanedioic acid
ఇతర పేర్లు
ethane-1,2-dicarboxylic acid
గుర్తింపు విషయాలు
సి.ఎ.ఎస్. సంఖ్య [110-15-6]
పబ్ కెమ్ 1110
డ్రగ్ బ్యాంకు DB00139
సి.హెచ్.ఇ.బి.ఐ CHEBI:15741
  • InChI=1/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)

మోలార్ ద్రవ్యరాశి 118.09 g·mol−1
సాంద్రత 1.56 g/cm3[1]
ద్రవీభవన స్థానం 184 °C (363 °F; 457 K)
బాష్పీభవన స్థానం 235 °C (455 °F; 508 K)
58 g/L (20 °C)[1]
ఆమ్లత్వం (pKa) pKa1 = 4.2
pKa2 = 5.6
జ్వలన స్థానం {{{value}}}
సంబంధిత సమ్మేళనాలు
ఇతరఅయాన్లు {{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is ☑Y☒N ?)
Infobox references

గది ఉష్ణోగ్రత వద్ద స్వచ్ఛమైన సక్సినికామ్లం వర్ణరహితమైన వాసనలేని స్పటికాలలాగా ఉంటుంది. దీని మెల్టింగ్ పాయింట్ 185 °C, మరుగు స్థానం 235 °C.


ఏంబర్ స్పిరిట్ ప్రాచీనకాలం నుండు ఏంబర్ (Amber) ను పొడి చేసి వడపోత ద్వారా తయారుచేసేవారు. దీనిని ఎక్కువగా కీళ్ళనొప్పుల ఉపశమనానికి వాడేవారు.

సక్సినిక్ ఆమ్లం ప్రస్తుత కాలంలో ఆహారం, మధ్యం పరిశ్రమలలో తీపి (Sweetener) కోసం వాడుతున్నారు. దీని ప్రపంచ ఉత్పత్తి సుమారు 16,000 - 30,000 టన్నులు.[2]
